C16H17N3O2 — CID 10214778
N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]acetamide (PubChem CID 10214778) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]acetamide.
| Compound Name | N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 10214778 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2n[nH]c(=O)c3c2CCCC3)c1 |
| InChI | InChI=1S/C16H17N3O2/c1-10(20)17-12-6-4-5-11(9-12)15-13-7-2-3-8-14(13)16(21)19-18-15/h4-6,9H,2-3,7-8H2,1H3,(H,17,20)(H,19,21) |
| InChIKey | IICIEOQDHWIAMK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |