C21H25ClN4O2 — CID 87217834
N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]-4-(prop-2-ynylamino)butanamide;hydrochloride (PubChem CID 87217834) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]-4-(prop-2-ynylamino)butanamide;hydrochloride.
| Compound Name | N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]-4-(prop-2-ynylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 87217834 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[3-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)phenyl]-4-(prop-2-ynylamino)butanamide;hydrochloride |
| SMILES | C#CCNCCCC(=O)Nc1cccc(-c2n[nH]c(=O)c3c2CCCC3)c1.Cl |
| InChI | InChI=1S/C21H24N4O2.ClH/c1-2-12-22-13-6-11-19(26)23-16-8-5-7-15(14-16)20-17-9-3-4-10-18(17)21(27)25-24-20;/h1,5,7-8,14,22H,3-4,6,9-13H2,(H,23,26)(H,25,27);1H |
| InChIKey | GEQWIMSXHGUJEM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|