C22H32N4O5S — CID 87217859
methanesulfonic acid;5-(methylamino)-N-[3-(4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyridazin-1-yl)phenyl]pentanamide (PubChem CID 87217859) has the molecular formula C22H32N4O5S and a molecular weight of 464.59 g/mol. Its IUPAC name is methanesulfonic acid;5-(methylamino)-N-[3-(4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyridazin-1-yl)phenyl]pentanamide.
| Compound Name | methanesulfonic acid;5-(methylamino)-N-[3-(4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyridazin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 87217859 |
| Molecular Formula | C22H32N4O5S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methanesulfonic acid;5-(methylamino)-N-[3-(4-oxo-3,5,6,7,8,9-hexahydrocyclohepta[d]pyridazin-1-yl)phenyl]pentanamide |
| SMILES | CNCCCCC(=O)Nc1cccc(-c2n[nH]c(=O)c3c2CCCCC3)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C21H28N4O2.CH4O3S/c1-22-13-6-5-12-19(26)23-16-9-7-8-15(14-16)20-17-10-3-2-4-11-18(17)21(27)25-24-20;1-5(2,3)4/h7-9,14,22H,2-6,10-13H2,1H3,(H,23,26)(H,25,27);1H3,(H,2,3,4) |
| InChIKey | VXQFTJHVSHWHFK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|