C21H24FN5 — CID 144999777
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(2-pyridin-4-ylethyl)pyridin-2-amine (PubChem CID 144999777) has the molecular formula C21H24FN5 and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(2-pyridin-4-ylethyl)pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(2-pyridin-4-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 144999777 |
| Molecular Formula | C21H24FN5 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(2-pyridin-4-ylethyl)pyridin-2-amine |
| SMILES | CC1(C)CCc2c(-c3cc(F)nc(NCCc4ccncc4)c3)n[nH]c2C1 |
| InChI | InChI=1S/C21H24FN5/c1-21(2)7-3-16-17(13-21)26-27-20(16)15-11-18(22)25-19(12-15)24-10-6-14-4-8-23-9-5-14/h4-5,8-9,11-12H,3,6-7,10,13H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | QXERSDVPKINGDY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|