C21H24FN5 — CID 145000125
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(4-methyl-3-pyridinyl)methyl]pyridin-2-amine (PubChem CID 145000125) has the molecular formula C21H24FN5 and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(4-methyl-3-pyridinyl)methyl]pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(4-methyl-3-pyridinyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 145000125 |
| Molecular Formula | C21H24FN5 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(4-methyl-3-pyridinyl)methyl]pyridin-2-amine |
| SMILES | Cc1ccncc1CNc1cc(-c2n[nH]c3c2CCC(C)(C)C3)cc(F)n1 |
| InChI | InChI=1S/C21H24FN5/c1-13-5-7-23-11-15(13)12-24-19-9-14(8-18(22)25-19)20-16-4-6-21(2,3)10-17(16)26-27-20/h5,7-9,11H,4,6,10,12H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | PZYFYIBJXUVEJG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|