C26H26FN5 — CID 145000230
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine (PubChem CID 145000230) has the molecular formula C26H26FN5 and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 145000230 |
| Molecular Formula | C26H26FN5 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine |
| SMILES | CC1(C)CCc2c(-c3cc(F)nc(NCc4cccc(-c5cccnc5)c4)c3)n[nH]c2C1 |
| InChI | InChI=1S/C26H26FN5/c1-26(2)9-8-21-22(14-26)31-32-25(21)20-12-23(27)30-24(13-20)29-15-17-5-3-6-18(11-17)19-7-4-10-28-16-19/h3-7,10-13,16H,8-9,14-15H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | CQNQPFZGWYUXHF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|