C21H29FN4 — CID 145000650
N-(cyclohexylmethyl)-4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoropyridin-2-amine (PubChem CID 145000650) has the molecular formula C21H29FN4 and a molecular weight of 356.49 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoropyridin-2-amine.
| Compound Name | N-(cyclohexylmethyl)-4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 145000650 |
| Molecular Formula | C21H29FN4 |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | N-(cyclohexylmethyl)-4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoropyridin-2-amine |
| SMILES | CC1(C)CCc2c(-c3cc(F)nc(NCC4CCCCC4)c3)n[nH]c2C1 |
| InChI | InChI=1S/C21H29FN4/c1-21(2)9-8-16-17(12-21)25-26-20(16)15-10-18(22)24-19(11-15)23-13-14-6-4-3-5-7-14/h10-11,14H,3-9,12-13H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | MKLDMROLXBAGGJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|