C22H40O2Si — CID 135066713
6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-8-methylidene-5-prop-2-enyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-4a-ol (PubChem CID 135066713) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-8-methylidene-5-prop-2-enyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-4a-ol.
| Compound Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-8-methylidene-5-prop-2-enyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 135066713 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-8-methylidene-5-prop-2-enyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-4a-ol |
| SMILES | C=CCC1(C)C(CO[Si](C)(C)C(C)(C)C)CC(=C)C2CCCCC21O |
| InChI | InChI=1S/C22H40O2Si/c1-9-13-21(6)18(16-24-25(7,8)20(3,4)5)15-17(2)19-12-10-11-14-22(19,21)23/h9,18-19,23H,1-2,10-16H2,3-8H3 |
| InChIKey | BSDPCLMZYKWEMC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|