C23H38O2Si — CID 10970803
(1S,3aS,5R,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol (PubChem CID 10970803) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (1S,3aS,5R,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol.
| Compound Name | (1S,3aS,5R,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
|---|---|
| PubChem CID | 10970803 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (1S,3aS,5R,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC[C@]2(O)C[C@H](c3ccccc3)CC[C@]12C |
| InChI | InChI=1S/C23H38O2Si/c1-21(2,3)26(5,6)25-17-20-13-15-23(24)16-19(12-14-22(20,23)4)18-10-8-7-9-11-18/h7-11,19-20,24H,12-17H2,1-6H3/t19-,20-,22-,23+/m1/s1 |
| InChIKey | XRVYTZFEMPADFF-PRTQVNTJSA-N |
| XLogP | 6.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|