C26H40O4 — CID 11144198
[(1R,2R,6R,7S,9R,12R,13S,16S,17E,20S)-17-ethylidene-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-yl] acetate (PubChem CID 11144198) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [(1R,2R,6R,7S,9R,12R,13S,16S,17E,20S)-17-ethylidene-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-yl] acetate.
| Compound Name | [(1R,2R,6R,7S,9R,12R,13S,16S,17E,20S)-17-ethylidene-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-yl] acetate |
|---|---|
| PubChem CID | 11144198 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(1R,2R,6R,7S,9R,12R,13S,16S,17E,20S)-17-ethylidene-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-yl] acetate |
| SMILES | C/C=C1\CC[C@H]2[C@@H]3[C@H]4OC(C)(C)O[C@@H]4[C@H]4C[C@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40O4/c1-7-16-8-9-18-21-19(11-13-25(16,18)5)26(6)12-10-17(28-15(2)27)14-20(26)22-23(21)30-24(3,4)29-22/h7,17-23H,8-14H2,1-6H3/b16-7+/t17-,18+,19+,20-,21+,22-,23-,25-,26-/m1/s1 |
| InChIKey | QUHPSIQGNIJYDL-KAZOCUIJSA-N |
| XLogP | 5.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|