C25H38O5 — CID 58700679
methyl (2E)-2-[(2R,6R,9S,12R,16S)-9-hydroxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ylidene]acetate (PubChem CID 58700679) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is methyl (2E)-2-[(2R,6R,9S,12R,16S)-9-hydroxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2R,6R,9S,12R,16S)-9-hydroxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ylidene]acetate |
|---|---|
| PubChem CID | 58700679 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | methyl (2E)-2-[(2R,6R,9S,12R,16S)-9-hydroxy-4,4,12,16-tetramethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-17-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CCC2C3C(CC[C@]12C)[C@@]1(C)CC[C@H](O)CC1[C@H]1OC(C)(C)O[C@H]31 |
| InChI | InChI=1S/C25H38O5/c1-23(2)29-21-18-13-15(26)8-10-25(18,4)17-9-11-24(3)14(12-19(27)28-5)6-7-16(24)20(17)22(21)30-23/h12,15-18,20-22,26H,6-11,13H2,1-5H3/b14-12+/t15-,16?,17?,18?,20?,21+,22+,24+,25+/m0/s1 |
| InChIKey | GBYNSICYOYJJKG-PVOODQIKSA-N |
| XLogP | 4.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|