C23H36O3 — CID 129044813
(6R)-4,4,12,16-tetramethyl-17-methylidene-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-ol (PubChem CID 129044813) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (6R)-4,4,12,16-tetramethyl-17-methylidene-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-ol.
| Compound Name | (6R)-4,4,12,16-tetramethyl-17-methylidene-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-ol |
|---|---|
| PubChem CID | 129044813 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (6R)-4,4,12,16-tetramethyl-17-methylidene-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icosan-9-ol |
| SMILES | C=C1CCC2C3C4OC(C)(C)O[C@@H]4C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C23H36O3/c1-13-6-7-15-18-16(9-11-22(13,15)4)23(5)10-8-14(24)12-17(23)19-20(18)26-21(2,3)25-19/h14-20,24H,1,6-12H2,2-5H3/t14?,15?,16?,17?,18?,19-,20?,22?,23?/m1/s1 |
| InChIKey | JBTKKLIVMXHACD-DVWFNRROSA-N |
| XLogP | 4.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|