C31H51NO2 — CID 144706247
4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;ethane;3-ethenyl-1-methyl-2-[(Z)-prop-1-enyl]pyrrole (PubChem CID 144706247) has the molecular formula C31H51NO2 and a molecular weight of 469.75 g/mol. Its IUPAC name is 4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;ethane;3-ethenyl-1-methyl-2-[(Z)-prop-1-enyl]pyrrole.
| Compound Name | 4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;ethane;3-ethenyl-1-methyl-2-[(Z)-prop-1-enyl]pyrrole |
|---|---|
| PubChem CID | 144706247 |
| Molecular Formula | C31H51NO2 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.39 |
| IUPAC Name | 4-(7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;ethane;3-ethenyl-1-methyl-2-[(Z)-prop-1-enyl]pyrrole |
| SMILES | C=C1CCC2CC(C3(C)CCC(O)CC3CO)CCC12C.C=Cc1ccn(C)c1/C=C\C.CC |
| InChI | InChI=1S/C19H32O2.C10H13N.C2H6/c1-13-4-5-14-10-15(6-8-18(13,14)2)19(3)9-7-17(21)11-16(19)12-20;1-4-6-10-9(5-2)7-8-11(10)3;1-2/h14-17,20-21H,1,4-12H2,2-3H3;4-8H,2H2,1,3H3;1-2H3/b;6-4-; |
| InChIKey | IGYTUYFVDIQSQW-GONQOWGMSA-N |
| XLogP | 7.65 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|