C28H41NO4 — CID 118953857
(1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[1,3-benzodioxol-5-yl(methyl)amino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol (PubChem CID 118953857) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is (1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[1,3-benzodioxol-5-yl(methyl)amino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol.
| Compound Name | (1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[1,3-benzodioxol-5-yl(methyl)amino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 118953857 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | (1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[1,3-benzodioxol-5-yl(methyl)amino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
| SMILES | C=C1CC[C@H]2[C@H](CN(C)c3ccc4c(c3)OCO4)[C@@H]([C@@]3(C)CC[C@H](O)C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C28H41NO4/c1-18-5-7-23-22(15-29(4)20-6-8-25-26(14-20)33-17-32-25)24(10-12-27(18,23)2)28(3)11-9-21(31)13-19(28)16-30/h6,8,14,19,21-24,30-31H,1,5,7,9-13,15-17H2,2-4H3/t19-,21+,22+,23+,24+,27-,28+/m1/s1 |
| InChIKey | ZZAASAJMQCJAPF-YORVENFTSA-N |
| XLogP | 5.01 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|