C20H35NO3 — CID 58103818
(1S,2R,4R,5S)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-(hydroxymethyl)-4-methylcyclohexane-1,2-diol (PubChem CID 58103818) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (1S,2R,4R,5S)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-(hydroxymethyl)-4-methylcyclohexane-1,2-diol.
| Compound Name | (1S,2R,4R,5S)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-(hydroxymethyl)-4-methylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 58103818 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (1S,2R,4R,5S)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-(hydroxymethyl)-4-methylcyclohexane-1,2-diol |
| SMILES | C=C1CCC2[C@H](CN)C([C@@]3(C)C[C@@H](O)[C@@H](O)C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C20H35NO3/c1-12-4-5-15-14(10-21)16(6-7-19(12,15)2)20(3)9-18(24)17(23)8-13(20)11-22/h13-18,22-24H,1,4-11,21H2,2-3H3/t13-,14+,15?,16?,17+,18-,19-,20+/m1/s1 |
| InChIKey | OCNCURVPRBWTAS-BEWGMISRSA-N |
| XLogP | 2.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|