C51H92N4O2 — CID 161004736
bis((1S,3S,4R)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[(cyclopentylamino)methyl]-4-methylcyclohexan-1-ol);methane (PubChem CID 161004736) has the molecular formula C51H92N4O2 and a molecular weight of 793.32 g/mol. Its IUPAC name is bis((1S,3S,4R)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[(cyclopentylamino)methyl]-4-methylcyclohexan-1-ol);methane.
| Compound Name | bis((1S,3S,4R)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[(cyclopentylamino)methyl]-4-methylcyclohexan-1-ol);methane |
|---|---|
| PubChem CID | 161004736 |
| Molecular Formula | C51H92N4O2 |
| Molecular Weight | 793.32 g/mol |
| Exact Mass | 792.72 |
| IUPAC Name | bis((1S,3S,4R)-4-[(4R,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-[(cyclopentylamino)methyl]-4-methylcyclohexan-1-ol);methane |
| SMILES | C.C=C1CCC2[C@H](CN)C([C@@]3(C)CC[C@H](O)C[C@@H]3CNC3CCCC3)CC[C@]12C.C=C1CCC2[C@H](CN)C([C@@]3(C)CC[C@H](O)C[C@@H]3CNC3CCCC3)CC[C@]12C |
| InChI | InChI=1S/2C25H44N2O.CH4/c2*1-17-8-9-22-21(15-26)23(11-13-24(17,22)2)25(3)12-10-20(28)14-18(25)16-27-19-6-4-5-7-19;/h2*18-23,27-28H,1,4-16,26H2,2-3H3;1H4/t2*18-,20+,21+,22?,23?,24-,25+;/m11./s1 |
| InChIKey | TWIVXLSUPMHBNY-CAOQFUAXSA-N |
| XLogP | 9.92 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.32 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|