C24H41NO2 — CID 142951406
(1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexan-1-ol (PubChem CID 142951406) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is (1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexan-1-ol.
| Compound Name | (1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 142951406 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (1S,3S,4R)-4-[(7aS)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methyl-3-(2-pyrrolidin-1-ylethoxy)cyclohexan-1-ol |
| SMILES | C=C1CCC2CC([C@@]3(C)CC[C@H](O)C[C@@H]3OCCN3CCCC3)CC[C@]12C |
| InChI | InChI=1S/C24H41NO2/c1-18-6-7-19-16-20(8-10-23(18,19)2)24(3)11-9-21(26)17-22(24)27-15-14-25-12-4-5-13-25/h19-22,26H,1,4-17H2,2-3H3/t19?,20?,21-,22-,23+,24+/m0/s1 |
| InChIKey | QVNVEKOAHONUOG-PQGKTVOSSA-N |
| XLogP | 4.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|