C20H37NO2 — CID 144706233
4-(1,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;methanamine (PubChem CID 144706233) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is 4-(1,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;methanamine.
| Compound Name | 4-(1,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;methanamine |
|---|---|
| PubChem CID | 144706233 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 4-(1,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-5-yl)-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;methanamine |
| SMILES | CC1=CCC2CC(C3(C)CCC(O)CC3CO)CCC12C.CN |
| InChI | InChI=1S/C19H32O2.CH5N/c1-13-4-5-14-10-15(6-8-18(13,14)2)19(3)9-7-17(21)11-16(19)12-20;1-2/h4,14-17,20-21H,5-12H2,1-3H3;2H2,1H3 |
| InChIKey | KXPJZXXNVGULBC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|