C37H52O5Si — CID 90423618
[(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate (PubChem CID 90423618) has the molecular formula C37H52O5Si and a molecular weight of 604.90 g/mol. Its IUPAC name is [(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate.
| Compound Name | [(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 90423618 |
| Molecular Formula | C37H52O5Si |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | [(3aR,4R,5R,7aS)-5-[(1S,2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@]2(C)CC[C@H](O)C[C@@H]2CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C37H52O5Si/c1-26(38)42-34-31-17-18-33(40)37(31,6)23-20-32(34)36(5)22-19-28(39)25-27(36)21-24-41-43(35(2,3)4,29-13-9-7-10-14-29)30-15-11-8-12-16-30/h7-16,27-28,31-32,34,39H,17-25H2,1-6H3/t27-,28-,31-,32-,34-,36-,37-/m0/s1 |
| InChIKey | ZMHRTTOAEWQRFE-LWBXLDEBSA-N |
| XLogP | 6.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|