C37H48O4Si — CID 10603408
(8'R,9'S,10'S,13'S,14'S)-10'-[[tert-butyl(diphenyl)silyl]oxymethyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 10603408) has the molecular formula C37H48O4Si and a molecular weight of 584.87 g/mol. Its IUPAC name is (8'R,9'S,10'S,13'S,14'S)-10'-[[tert-butyl(diphenyl)silyl]oxymethyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'R,9'S,10'S,13'S,14'S)-10'-[[tert-butyl(diphenyl)silyl]oxymethyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 10603408 |
| Molecular Formula | C37H48O4Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | (8'R,9'S,10'S,13'S,14'S)-10'-[[tert-butyl(diphenyl)silyl]oxymethyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CC(C)(C)[Si](OC[C@]12CCC3(CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12)OCCO3)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H48O4Si/c1-34(2,3)42(28-11-7-5-8-12-28,29-13-9-6-10-14-29)41-26-36-21-22-37(39-23-24-40-37)25-27(36)15-16-30-31-17-18-33(38)35(31,4)20-19-32(30)36/h5-15,30-32H,16-26H2,1-4H3/t30-,31-,32-,35-,36+/m0/s1 |
| InChIKey | SIDVTFCDINOPCB-QLQDGJKWSA-N |
| XLogP | 6.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|