C24H43NO2 — CID 11259565
(4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-4-methylpentyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol (PubChem CID 11259565) has the molecular formula C24H43NO2 and a molecular weight of 377.61 g/mol. Its IUPAC name is (4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-4-methylpentyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol.
| Compound Name | (4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-4-methylpentyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
|---|---|
| PubChem CID | 11259565 |
| Molecular Formula | C24H43NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | (4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-4-methylpentyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
| SMILES | C=C1CCC2[C@@H](O)C([C@@]3(C)CC[C@H](O)C[C@@H]3CC(N)CC(C)C)CC[C@@]12C |
| InChI | InChI=1S/C24H43NO2/c1-15(2)12-18(25)13-17-14-19(26)8-10-24(17,5)21-9-11-23(4)16(3)6-7-20(23)22(21)27/h15,17-22,26-27H,3,6-14,25H2,1-2,4-5H3/t17-,18?,19-,20?,21?,22+,23-,24-/m0/s1 |
| InChIKey | PISIFEQPYACWIO-BFIVHLMSSA-N |
| XLogP | 4.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|