C28H52N2O4 — CID 11375057
azanium;(4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-2-cyclohexylethyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;acetate (PubChem CID 11375057) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is azanium;(4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-2-cyclohexylethyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;acetate.
| Compound Name | azanium;(4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-2-cyclohexylethyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;acetate |
|---|---|
| PubChem CID | 11375057 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | azanium;(4S,7aR)-5-[(1S,2S,4S)-2-(2-amino-2-cyclohexylethyl)-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;acetate |
| SMILES | C=C1CCC2[C@@H](O)C([C@@]3(C)CC[C@H](O)C[C@@H]3CC(N)C3CCCCC3)CC[C@@]12C.CC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C26H45NO2.C2H4O2.H3N/c1-17-9-10-21-24(29)22(12-14-25(17,21)2)26(3)13-11-20(28)15-19(26)16-23(27)18-7-5-4-6-8-18;1-2(3)4;/h18-24,28-29H,1,4-16,27H2,2-3H3;1H3,(H,3,4);1H3/t19-,20+,21?,22?,23?,24-,25+,26+;;/m1../s1 |
| InChIKey | PUZFVSWLJCWERR-CHZUWQSOSA-N |
| XLogP | 4.33 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|