C31H49ClO2 — CID 142951380
(4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;ethane (PubChem CID 142951380) has the molecular formula C31H49ClO2 and a molecular weight of 489.18 g/mol. Its IUPAC name is (4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;ethane.
| Compound Name | (4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;ethane |
|---|---|
| PubChem CID | 142951380 |
| Molecular Formula | C31H49ClO2 |
| Molecular Weight | 489.18 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol;ethane |
| SMILES | C=C1CCC2[C@H](O)C(C3(C)CCC(O)CC3C/C=C\c3ccc(Cl)cc3)CCC12C.CC.CC |
| InChI | InChI=1S/C27H37ClO2.2C2H6/c1-18-7-12-23-25(30)24(14-16-26(18,23)2)27(3)15-13-22(29)17-20(27)6-4-5-19-8-10-21(28)11-9-19;2*1-2/h4-5,8-11,20,22-25,29-30H,1,6-7,12-17H2,2-3H3;2*1-2H3/b5-4-;;/t20?,22?,23?,24?,25-,26?,27?;;/m0../s1 |
| InChIKey | QNKFAIODBBPTNJ-WSBZWXKUSA-N |
| XLogP | 8.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.18 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|