C30H47ClO3 — CID 142951399
(4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-4-hydroxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one;ethane (PubChem CID 142951399) has the molecular formula C30H47ClO3 and a molecular weight of 491.16 g/mol. Its IUPAC name is (4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-4-hydroxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one;ethane.
| Compound Name | (4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-4-hydroxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one;ethane |
|---|---|
| PubChem CID | 142951399 |
| Molecular Formula | C30H47ClO3 |
| Molecular Weight | 491.16 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | (4R)-5-[2-[(Z)-3-(4-chlorophenyl)prop-2-enyl]-4-hydroxy-1-methylcyclohexyl]-4-hydroxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one;ethane |
| SMILES | CC.CC.CC12CCC(C3(C)CCC(O)CC3C/C=C\c3ccc(Cl)cc3)[C@@H](O)C1CCC2=O |
| InChI | InChI=1S/C26H35ClO3.2C2H6/c1-25(22-13-15-26(2)21(24(22)30)10-11-23(26)29)14-12-20(28)16-18(25)5-3-4-17-6-8-19(27)9-7-17;2*1-2/h3-4,6-9,18,20-22,24,28,30H,5,10-16H2,1-2H3;2*1-2H3/b4-3-;;/t18?,20?,21?,22?,24-,25?,26?;;/m0../s1 |
| InChIKey | XIIBBCCJSNWVRR-FHYHYYMKSA-N |
| XLogP | 7.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.16 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |