C24H37NO3 — CID 11155515
(4S,7aR)-5-[(1S,2S,4S)-2-[(furan-2-ylmethylamino)methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol (PubChem CID 11155515) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is (4S,7aR)-5-[(1S,2S,4S)-2-[(furan-2-ylmethylamino)methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol.
| Compound Name | (4S,7aR)-5-[(1S,2S,4S)-2-[(furan-2-ylmethylamino)methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
|---|---|
| PubChem CID | 11155515 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | (4S,7aR)-5-[(1S,2S,4S)-2-[(furan-2-ylmethylamino)methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
| SMILES | C=C1CCC2[C@@H](O)C([C@@]3(C)CC[C@H](O)C[C@@H]3CNCc3ccco3)CC[C@@]12C |
| InChI | InChI=1S/C24H37NO3/c1-16-6-7-20-22(27)21(9-11-23(16,20)2)24(3)10-8-18(26)13-17(24)14-25-15-19-5-4-12-28-19/h4-5,12,17-18,20-22,25-27H,1,6-11,13-15H2,2-3H3/t17-,18+,20?,21?,22-,23+,24+/m1/s1 |
| InChIKey | BEAOSSRGAXKAAW-ANQVGAAJSA-N |
| XLogP | 4.28 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|