C25H38N2O2 — CID 11372932
(1S,3S,4R)-4-[(4R,7aR)-7a-methyl-1-methylidene-4-[(pyridin-3-ylmethylamino)methyl]-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol (PubChem CID 11372932) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (1S,3S,4R)-4-[(4R,7aR)-7a-methyl-1-methylidene-4-[(pyridin-3-ylmethylamino)methyl]-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol.
| Compound Name | (1S,3S,4R)-4-[(4R,7aR)-7a-methyl-1-methylidene-4-[(pyridin-3-ylmethylamino)methyl]-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11372932 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (1S,3S,4R)-4-[(4R,7aR)-7a-methyl-1-methylidene-4-[(pyridin-3-ylmethylamino)methyl]-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-4-methylcyclohexane-1,3-diol |
| SMILES | C=C1CCC2[C@@H](CNCc3cccnc3)C([C@@]3(C)CC[C@H](O)C[C@@H]3O)CC[C@@]12C |
| InChI | InChI=1S/C25H38N2O2/c1-17-6-7-21-20(16-27-15-18-5-4-12-26-14-18)22(9-11-24(17,21)2)25(3)10-8-19(28)13-23(25)29/h4-5,12,14,19-23,27-29H,1,6-11,13,15-16H2,2-3H3/t19-,20+,21?,22?,23-,24-,25+/m0/s1 |
| InChIKey | ZVCMQGJNEDBLRW-FWNDPPAWSA-N |
| XLogP | 4.08 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|