C22H40O4Si — CID 100985279
(3S,5S)-3-[(1S,2R,5R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,5-dimethyl-4-oxocyclohexyl]-3,5-dimethyloxolan-2-one (PubChem CID 100985279) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (3S,5S)-3-[(1S,2R,5R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,5-dimethyl-4-oxocyclohexyl]-3,5-dimethyloxolan-2-one.
| Compound Name | (3S,5S)-3-[(1S,2R,5R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,5-dimethyl-4-oxocyclohexyl]-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 100985279 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (3S,5S)-3-[(1S,2R,5R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,5-dimethyl-4-oxocyclohexyl]-3,5-dimethyloxolan-2-one |
| SMILES | C[C@@H]1C[C@](C)([C@]2(C)C[C@H](C)OC2=O)[C@H](CCO[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C22H40O4Si/c1-15-13-21(6,22(7)14-16(2)26-19(22)24)17(12-18(15)23)10-11-25-27(8,9)20(3,4)5/h15-17H,10-14H2,1-9H3/t15-,16+,17-,21+,22-/m1/s1 |
| InChIKey | CVJZRNAUHBHTQU-OKYVINKXSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|