C39H50O4Si — CID 101084149
(1S,2R,5S,6R,8S,10S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(trityloxymethyl)-12-oxatricyclo[6.3.1.01,6]dodecan-11-one (PubChem CID 101084149) has the molecular formula C39H50O4Si and a molecular weight of 610.91 g/mol. Its IUPAC name is (1S,2R,5S,6R,8S,10S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(trityloxymethyl)-12-oxatricyclo[6.3.1.01,6]dodecan-11-one.
| Compound Name | (1S,2R,5S,6R,8S,10S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(trityloxymethyl)-12-oxatricyclo[6.3.1.01,6]dodecan-11-one |
|---|---|
| PubChem CID | 101084149 |
| Molecular Formula | C39H50O4Si |
| Molecular Weight | 610.91 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | (1S,2R,5S,6R,8S,10S)-5-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(trityloxymethyl)-12-oxatricyclo[6.3.1.01,6]dodecan-11-one |
| SMILES | C[C@H]1C[C@H]2C[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H](COC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@]3(O2)C1=O |
| InChI | InChI=1S/C39H50O4Si/c1-28-25-33-26-37(5)34(43-44(6,7)36(2,3)4)24-23-32(39(37,42-33)35(28)40)27-41-38(29-17-11-8-12-18-29,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h8-22,28,32-34H,23-27H2,1-7H3/t28-,32+,33-,34-,37+,39+/m0/s1 |
| InChIKey | WJNRFIWSWQLFIX-BFGIMGROSA-N |
| XLogP | 8.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.91 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|