C37H53BO5Si2 — CID 146029384
CID 146029384 (PubChem CID 146029384) has the molecular formula C37H53BO5Si2 and a molecular weight of 644.81 g/mol.
| Compound Name | CID 146029384 |
|---|---|
| PubChem CID | 146029384 |
| Molecular Formula | C37H53BO5Si2 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.35 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@@](CO)(COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H53BO5Si2/c1-34(2,3)44(7,8)42-31-32(43-45(9,10)35(4,5)6)36(26-39,41-33(31)38)27-40-37(28-20-14-11-15-21-28,29-22-16-12-17-23-29)30-24-18-13-19-25-30/h11-25,31-33,39H,26-27H2,1-10H3/t31-,32+,33-,36+/m1/s1 |
| InChIKey | GVWYIKITQNVYCV-ZHYHXGNXSA-N |
| XLogP | 8.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|