C14H29BO4Si — CID 88572294
CID 88572294 (PubChem CID 88572294) has the molecular formula C14H29BO4Si and a molecular weight of 300.28 g/mol.
| Compound Name | CID 88572294 |
|---|---|
| PubChem CID | 88572294 |
| Molecular Formula | C14H29BO4Si |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@@](CO)(CCO)[C@H](C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29BO4Si/c1-10-11(19-20(5,6)13(2,3)4)12(15)18-14(10,9-17)7-8-16/h10-12,16-17H,7-9H2,1-6H3/t10-,11?,12-,14-/m1/s1 |
| InChIKey | JFSCPVZHNYNUOW-ALHXXGQPSA-N |
| XLogP | 1.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|