C17H34O4Si — CID 11595116
[(5S,7S,8R,9S,10S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-dimethyl-1,6-dioxaspiro[4.5]decan-7-yl]methanol (PubChem CID 11595116) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is [(5S,7S,8R,9S,10S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-dimethyl-1,6-dioxaspiro[4.5]decan-7-yl]methanol.
| Compound Name | [(5S,7S,8R,9S,10S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-dimethyl-1,6-dioxaspiro[4.5]decan-7-yl]methanol |
|---|---|
| PubChem CID | 11595116 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(5S,7S,8R,9S,10S)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-dimethyl-1,6-dioxaspiro[4.5]decan-7-yl]methanol |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)O[C@@]2(CCCO2)[C@H]1C |
| InChI | InChI=1S/C17H34O4Si/c1-12-13(2)17(9-8-10-19-17)20-14(11-18)15(12)21-22(6,7)16(3,4)5/h12-15,18H,8-11H2,1-7H3/t12-,13-,14-,15+,17-/m0/s1 |
| InChIKey | BIDIQHOMGDUMSR-JGFGOLAASA-N |
| XLogP | 3.55 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|