C11H24O3Si — CID 138965172
[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-tritiooxolan-2-yl]methanol (PubChem CID 138965172) has the molecular formula C11H24O3Si and a molecular weight of 234.40 g/mol. Its IUPAC name is [(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-tritiooxolan-2-yl]methanol.
| Compound Name | [(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-tritiooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 138965172 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 234.40 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | [(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-tritiooxolan-2-yl]methanol |
| SMILES | [3H][C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H24O3Si/c1-11(2,3)15(4,5)14-9-6-7-13-10(9)8-12/h9-10,12H,6-8H2,1-5H3/t9-,10-/m1/s1/i7T/t7-,9+,10+/m0 |
| InChIKey | SVIWZMUURILMAT-YXKXWXIESA-N |
| XLogP | 2.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|