C14H27BO3Si — CID 58078375
CID 58078375 (PubChem CID 58078375) has the molecular formula C14H27BO3Si and a molecular weight of 282.26 g/mol.
| Compound Name | CID 58078375 |
|---|---|
| PubChem CID | 58078375 |
| Molecular Formula | C14H27BO3Si |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@](C=O)(CC)[C@@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27BO3Si/c1-8-14(9-16)10(2)11(12(15)17-14)18-19(6,7)13(3,4)5/h9-12H,8H2,1-7H3/t10-,11+,12+,14-/m0/s1 |
| InChIKey | ZAEOXLGOWVTFJQ-SFTQSGBHSA-N |
| XLogP | 2.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|