C18H28N4O4Si — CID 131743853
(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolane-2-carbaldehyde (PubChem CID 131743853) has the molecular formula C18H28N4O4Si and a molecular weight of 392.53 g/mol. Its IUPAC name is (2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolane-2-carbaldehyde.
| Compound Name | (2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 131743853 |
| Molecular Formula | C18H28N4O4Si |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)oxolane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](c2ccc3c(N)ncnn23)O[C@]1(C=O)CO |
| InChI | InChI=1S/C18H28N4O4Si/c1-17(2,3)27(4,5)26-15-8-14(25-18(15,9-23)10-24)12-6-7-13-16(19)20-11-21-22(12)13/h6-7,9,11,14-15,24H,8,10H2,1-5H3,(H2,19,20,21)/t14-,15+,18-/m1/s1 |
| InChIKey | XFIITMZXBXMARD-RVKKMQEKSA-N |
| XLogP | 2.09 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|