C25H31N5O5Si — CID 169174638
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 169174638) has the molecular formula C25H31N5O5Si and a molecular weight of 509.64 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 169174638 |
| Molecular Formula | C25H31N5O5Si |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-3-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](c2ccc3c(N)ncnn23)O[C@](C#N)(COC(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C25H31N5O5Si/c1-24(2,3)36(4,5)35-20-19(17-11-12-18-22(27)28-15-29-30(17)18)34-25(13-26,21(20)31)14-33-23(32)16-9-7-6-8-10-16/h6-12,15,19-21,31H,14H2,1-5H3,(H2,27,28,29)/t19-,20-,21-,25+/m0/s1 |
| InChIKey | YSRHIGOUAKAUJY-AIFLQVKLSA-N |
| XLogP | 3.25 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|