C24H42BO5PSi — CID 88572141
CID 88572141 (PubChem CID 88572141) has the molecular formula C24H42BO5PSi and a molecular weight of 480.47 g/mol.
| Compound Name | CID 88572141 |
|---|---|
| PubChem CID | 88572141 |
| Molecular Formula | C24H42BO5PSi |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@](CC)(CCP(C)(=O)OCC)[C@H](OCc2ccccc2)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42BO5PSi/c1-9-24(16-17-31(6,26)28-10-2)21(27-18-19-14-12-11-13-15-19)20(22(25)29-24)30-32(7,8)23(3,4)5/h11-15,20-22H,9-10,16-18H2,1-8H3/t20?,21-,22-,24-,31?/m1/s1 |
| InChIKey | OTTHWDLKIVYJCF-PNNDOJAFSA-N |
| XLogP | 5.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|