C15H17BO3 — CID 158872539
CID 158872539 (PubChem CID 158872539) has the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol.
| Compound Name | CID 158872539 |
|---|---|
| PubChem CID | 158872539 |
| Molecular Formula | C15H17BO3 |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@@]2(CC)CC(=O)[C@@H]1[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C15H17BO3/c1-2-15-8-11(17)12(14(16)19-15)13(15)18-9-10-6-4-3-5-7-10/h3-7,12-14H,2,8-9H2,1H3/t12-,13+,14-,15+/m1/s1 |
| InChIKey | RACOPWDTBASGPF-BARDWOONSA-N |
| XLogP | 1.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|