C14H20O4 — CID 158000420
(3S,4S,5R)-5-ethyl-5-(hydroxymethyl)-4-phenylmethoxyoxolan-3-ol (PubChem CID 158000420) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3S,4S,5R)-5-ethyl-5-(hydroxymethyl)-4-phenylmethoxyoxolan-3-ol.
| Compound Name | (3S,4S,5R)-5-ethyl-5-(hydroxymethyl)-4-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 158000420 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3S,4S,5R)-5-ethyl-5-(hydroxymethyl)-4-phenylmethoxyoxolan-3-ol |
| SMILES | CC[C@]1(CO)OC[C@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H20O4/c1-2-14(10-15)13(12(16)9-18-14)17-8-11-6-4-3-5-7-11/h3-7,12-13,15-16H,2,8-10H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | GVUZRCKDQVQHIH-MELADBBJSA-N |
| XLogP | 1.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |