C23H28O6 — CID 101138684
(5S,6S,7R,8R)-2,2-dimethyl-6,7-bis(phenylmethoxy)-1,3,10-trioxaspiro[4.5]decan-8-ol (PubChem CID 101138684) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (5S,6S,7R,8R)-2,2-dimethyl-6,7-bis(phenylmethoxy)-1,3,10-trioxaspiro[4.5]decan-8-ol.
| Compound Name | (5S,6S,7R,8R)-2,2-dimethyl-6,7-bis(phenylmethoxy)-1,3,10-trioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 101138684 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (5S,6S,7R,8R)-2,2-dimethyl-6,7-bis(phenylmethoxy)-1,3,10-trioxaspiro[4.5]decan-8-ol |
| SMILES | CC1(C)OC[C@]2(OC[C@@H](O)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H28O6/c1-22(2)28-16-23(29-22)21(26-14-18-11-7-4-8-12-18)20(19(24)15-27-23)25-13-17-9-5-3-6-10-17/h3-12,19-21,24H,13-16H2,1-2H3/t19-,20-,21+,23+/m1/s1 |
| InChIKey | AGEQUUKMHUQSKY-JFYQVNSESA-N |
| XLogP | 3.03 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |