C18H42O6Si4 — CID 101410633
(5S,6S,7R,8R)-2,2-dimethyl-7-tris(trimethylsilyl)silyloxy-1,3,10-trioxaspiro[4.5]decane-6,8-diol (PubChem CID 101410633) has the molecular formula C18H42O6Si4 and a molecular weight of 466.87 g/mol. Its IUPAC name is (5S,6S,7R,8R)-2,2-dimethyl-7-tris(trimethylsilyl)silyloxy-1,3,10-trioxaspiro[4.5]decane-6,8-diol.
| Compound Name | (5S,6S,7R,8R)-2,2-dimethyl-7-tris(trimethylsilyl)silyloxy-1,3,10-trioxaspiro[4.5]decane-6,8-diol |
|---|---|
| PubChem CID | 101410633 |
| Molecular Formula | C18H42O6Si4 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (5S,6S,7R,8R)-2,2-dimethyl-7-tris(trimethylsilyl)silyloxy-1,3,10-trioxaspiro[4.5]decane-6,8-diol |
| SMILES | CC1(C)OC[C@]2(OC[C@@H](O)[C@@H](O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)O1 |
| InChI | InChI=1S/C18H42O6Si4/c1-17(2)22-13-18(24-17)16(20)15(14(19)12-21-18)23-28(25(3,4)5,26(6,7)8)27(9,10)11/h14-16,19-20H,12-13H2,1-11H3/t14-,15-,16+,18+/m1/s1 |
| InChIKey | IIJZFMGBBOVQRU-CBZIJGRNSA-N |
| XLogP | 2.80 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|