C16H21FO5 — CID 134933768
(5S,6S,7R,8R)-7-fluoro-2,2-dimethyl-8-phenylmethoxy-1,3,10-trioxaspiro[4.5]decan-6-ol (PubChem CID 134933768) has the molecular formula C16H21FO5 and a molecular weight of 312.34 g/mol. Its IUPAC name is (5S,6S,7R,8R)-7-fluoro-2,2-dimethyl-8-phenylmethoxy-1,3,10-trioxaspiro[4.5]decan-6-ol.
| Compound Name | (5S,6S,7R,8R)-7-fluoro-2,2-dimethyl-8-phenylmethoxy-1,3,10-trioxaspiro[4.5]decan-6-ol |
|---|---|
| PubChem CID | 134933768 |
| Molecular Formula | C16H21FO5 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (5S,6S,7R,8R)-7-fluoro-2,2-dimethyl-8-phenylmethoxy-1,3,10-trioxaspiro[4.5]decan-6-ol |
| SMILES | CC1(C)OC[C@]2(OC[C@@H](OCc3ccccc3)[C@H](F)[C@H]2O)O1 |
| InChI | InChI=1S/C16H21FO5/c1-15(2)21-10-16(22-15)14(18)13(17)12(9-20-16)19-8-11-6-4-3-5-7-11/h3-7,12-14,18H,8-10H2,1-2H3/t12-,13+,14-,16+/m1/s1 |
| InChIKey | LNUNPNOQDJXDTB-CTASWTNQSA-N |
| XLogP | 1.78 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |