C25H41O8PSi — CID 57343236
tert-butyl-[[(1S,3R,5S,6R,7R,8S,9S)-8-(diethoxyphosphorylmethyl)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl]oxy]-dimethylsilane (PubChem CID 57343236) has the molecular formula C25H41O8PSi and a molecular weight of 528.66 g/mol. Its IUPAC name is tert-butyl-[[(1S,3R,5S,6R,7R,8S,9S)-8-(diethoxyphosphorylmethyl)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,3R,5S,6R,7R,8S,9S)-8-(diethoxyphosphorylmethyl)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 57343236 |
| Molecular Formula | C25H41O8PSi |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | tert-butyl-[[(1S,3R,5S,6R,7R,8S,9S)-8-(diethoxyphosphorylmethyl)-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl]oxy]-dimethylsilane |
| SMILES | CCOP(=O)(C[C@@H]1[C@H]2O[C@@H]3O[C@@H]([C@@H](OCc4ccccc4)[C@H]1O3)[C@@H]2O[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C25H41O8PSi/c1-8-28-34(26,29-9-2)16-18-19-21(27-15-17-13-11-10-12-14-17)22-23(20(18)31-24(30-19)32-22)33-35(6,7)25(3,4)5/h10-14,18-24H,8-9,15-16H2,1-7H3/t18-,19-,20+,21-,22-,23+,24+/m0/s1 |
| InChIKey | BCDXIRJVXGTUHI-YFEFPGCXSA-N |
| XLogP | 5.32 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|