C21H30O9SSi — CID 10994547
[(1R,3S,5S,6S,7R,8R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methylsulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate (PubChem CID 10994547) has the molecular formula C21H30O9SSi and a molecular weight of 486.62 g/mol. Its IUPAC name is [(1R,3S,5S,6S,7R,8R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methylsulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate.
| Compound Name | [(1R,3S,5S,6S,7R,8R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methylsulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate |
|---|---|
| PubChem CID | 10994547 |
| Molecular Formula | C21H30O9SSi |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [(1R,3S,5S,6S,7R,8R,9R)-8-[tert-butyl(dimethyl)silyl]oxy-9-methylsulfonyloxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]2O[C@@H]3O[C@H]1[C@H](OS(C)(=O)=O)[C@@H](O3)[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H30O9SSi/c1-21(2,3)32(5,6)30-18-15-13(25-19(22)12-10-8-7-9-11-12)14-17(29-31(4,23)24)16(18)28-20(26-14)27-15/h7-11,13-18,20H,1-6H3/t13-,14+,15-,16+,17-,18-,20-/m1/s1 |
| InChIKey | STCHINJALPGUMZ-FODLKZINSA-N |
| XLogP | 2.43 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|