C27H34O9Si — CID 70948251
methyl (3S,4R)-4,5-dibenzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxane-2-carboxylate (PubChem CID 70948251) has the molecular formula C27H34O9Si and a molecular weight of 530.65 g/mol. Its IUPAC name is methyl (3S,4R)-4,5-dibenzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxane-2-carboxylate.
| Compound Name | methyl (3S,4R)-4,5-dibenzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 70948251 |
| Molecular Formula | C27H34O9Si |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | methyl (3S,4R)-4,5-dibenzoyloxy-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)C1OC(O)C(OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H34O9Si/c1-27(2,3)37(5,6)36-20-19(33-23(28)17-13-9-7-10-14-17)21(26(31)35-22(20)25(30)32-4)34-24(29)18-15-11-8-12-16-18/h7-16,19-22,26,31H,1-6H3/t19-,20-,21?,22?,26?/m0/s1 |
| InChIKey | IDVLXCWXEZISPF-ISYDYUEHSA-N |
| XLogP | 3.72 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|