C23H23ClO9 — CID 10906936
methyl (2R,3S,4S,5R)-5-benzoyloxy-3-(2-chloroacetyl)oxy-6-hydroxy-4-phenylmethoxyoxane-2-carboxylate (PubChem CID 10906936) has the molecular formula C23H23ClO9 and a molecular weight of 478.88 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-5-benzoyloxy-3-(2-chloroacetyl)oxy-6-hydroxy-4-phenylmethoxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R)-5-benzoyloxy-3-(2-chloroacetyl)oxy-6-hydroxy-4-phenylmethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10906936 |
| Molecular Formula | C23H23ClO9 |
| Molecular Weight | 478.88 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | methyl (2R,3S,4S,5R)-5-benzoyloxy-3-(2-chloroacetyl)oxy-6-hydroxy-4-phenylmethoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(O)[C@H](OC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OC(=O)CCl |
| InChI | InChI=1S/C23H23ClO9/c1-29-22(27)20-18(31-16(25)12-24)17(30-13-14-8-4-2-5-9-14)19(23(28)33-20)32-21(26)15-10-6-3-7-11-15/h2-11,17-20,23,28H,12-13H2,1H3/t17-,18-,19+,20+,23?/m0/s1 |
| InChIKey | ZUQYTPKCSRDMAH-AQIKNHSSSA-N |
| XLogP | 1.84 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.88 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|