C30H30O9S — CID 159037997
[(3R,5R,6S)-3,5-dibenzoyloxy-2,6-dimethyl-4-methylsulfonyloxycyclohexyl] benzoate (PubChem CID 159037997) has the molecular formula C30H30O9S and a molecular weight of 566.63 g/mol. Its IUPAC name is [(3R,5R,6S)-3,5-dibenzoyloxy-2,6-dimethyl-4-methylsulfonyloxycyclohexyl] benzoate.
| Compound Name | [(3R,5R,6S)-3,5-dibenzoyloxy-2,6-dimethyl-4-methylsulfonyloxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 159037997 |
| Molecular Formula | C30H30O9S |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [(3R,5R,6S)-3,5-dibenzoyloxy-2,6-dimethyl-4-methylsulfonyloxycyclohexyl] benzoate |
| SMILES | CC1C(OC(=O)c2ccccc2)C(C)[C@@H](OC(=O)c2ccccc2)C(OS(C)(=O)=O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H30O9S/c1-19-24(36-28(31)21-13-7-4-8-14-21)20(2)26(38-30(33)23-17-11-6-12-18-23)27(39-40(3,34)35)25(19)37-29(32)22-15-9-5-10-16-22/h4-20,24-27H,1-3H3/t19?,20?,24?,25-,26-,27?/m1/s1 |
| InChIKey | MLENWSQIYUERHS-JVBAERIFSA-N |
| XLogP | 4.29 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|