C19H20O6S2 — CID 131740616
[(3S,4R,6S)-4-methylsulfonyloxy-6-phenyl-6-sulfanyloxan-3-yl] benzoate (PubChem CID 131740616) has the molecular formula C19H20O6S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(3S,4R,6S)-4-methylsulfonyloxy-6-phenyl-6-sulfanyloxan-3-yl] benzoate.
| Compound Name | [(3S,4R,6S)-4-methylsulfonyloxy-6-phenyl-6-sulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 131740616 |
| Molecular Formula | C19H20O6S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [(3S,4R,6S)-4-methylsulfonyloxy-6-phenyl-6-sulfanyloxan-3-yl] benzoate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@](S)(c2ccccc2)OC[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O6S2/c1-27(21,22)25-16-12-19(26,15-10-6-3-7-11-15)23-13-17(16)24-18(20)14-8-4-2-5-9-14/h2-11,16-17,26H,12-13H2,1H3/t16-,17+,19+/m1/s1 |
| InChIKey | GEDJPYOGKGWNJP-AOIWGVFYSA-N |
| XLogP | 2.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|