C16H20O9S — CID 10691671
[(1S,3R,4R,5R)-3,4-dihydroxy-1-methoxycarbonyl-5-methylsulfonyloxycyclohexyl] benzoate (PubChem CID 10691671) has the molecular formula C16H20O9S and a molecular weight of 388.39 g/mol. Its IUPAC name is [(1S,3R,4R,5R)-3,4-dihydroxy-1-methoxycarbonyl-5-methylsulfonyloxycyclohexyl] benzoate.
| Compound Name | [(1S,3R,4R,5R)-3,4-dihydroxy-1-methoxycarbonyl-5-methylsulfonyloxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 10691671 |
| Molecular Formula | C16H20O9S |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [(1S,3R,4R,5R)-3,4-dihydroxy-1-methoxycarbonyl-5-methylsulfonyloxycyclohexyl] benzoate |
| SMILES | COC(=O)[C@]1(OC(=O)c2ccccc2)C[C@@H](O)[C@@H](O)[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H20O9S/c1-23-15(20)16(24-14(19)10-6-4-3-5-7-10)8-11(17)13(18)12(9-16)25-26(2,21)22/h3-7,11-13,17-18H,8-9H2,1-2H3/t11-,12-,13-,16+/m1/s1 |
| InChIKey | KFCWDMUGFCTHGJ-JXFSHQFZSA-N |
| XLogP | -0.38 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|