C29H31NO6 — CID 10838747
[(1R,3R,4S,5R)-3-(dibenzylamino)-4,5-dihydroxy-1-methoxycarbonylcyclohexyl] benzoate (PubChem CID 10838747) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is [(1R,3R,4S,5R)-3-(dibenzylamino)-4,5-dihydroxy-1-methoxycarbonylcyclohexyl] benzoate.
| Compound Name | [(1R,3R,4S,5R)-3-(dibenzylamino)-4,5-dihydroxy-1-methoxycarbonylcyclohexyl] benzoate |
|---|---|
| PubChem CID | 10838747 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | [(1R,3R,4S,5R)-3-(dibenzylamino)-4,5-dihydroxy-1-methoxycarbonylcyclohexyl] benzoate |
| SMILES | COC(=O)[C@]1(OC(=O)c2ccccc2)C[C@@H](O)[C@@H](O)[C@H](N(Cc2ccccc2)Cc2ccccc2)C1 |
| InChI | InChI=1S/C29H31NO6/c1-35-28(34)29(36-27(33)23-15-9-4-10-16-23)17-24(26(32)25(31)18-29)30(19-21-11-5-2-6-12-21)20-22-13-7-3-8-14-22/h2-16,24-26,31-32H,17-20H2,1H3/t24-,25-,26+,29-/m1/s1 |
| InChIKey | XCXJONJKAMSUIU-NANFOGFDSA-N |
| XLogP | 3.34 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |