C26H21BrO8 — CID 141187477
[(3R,4S,5R,6R)-4,5-dibenzoyloxy-6-bromo-6-hydroxyoxan-3-yl] benzoate (PubChem CID 141187477) has the molecular formula C26H21BrO8 and a molecular weight of 541.35 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-dibenzoyloxy-6-bromo-6-hydroxyoxan-3-yl] benzoate.
| Compound Name | [(3R,4S,5R,6R)-4,5-dibenzoyloxy-6-bromo-6-hydroxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 141187477 |
| Molecular Formula | C26H21BrO8 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-dibenzoyloxy-6-bromo-6-hydroxyoxan-3-yl] benzoate |
| SMILES | O=C(OC1CO[C@@](O)(Br)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21BrO8/c27-26(31)22(35-25(30)19-14-8-3-9-15-19)21(34-24(29)18-12-6-2-7-13-18)20(16-32-26)33-23(28)17-10-4-1-5-11-17/h1-15,20-22,31H,16H2/t20?,21-,22+,26+/m0/s1 |
| InChIKey | BPKUOEDXDKWZPH-AWHCJVEHSA-N |
| XLogP | 3.73 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|